C13H21N5 — CID 42623888
4-cyclopentyl-6-[3-(methylamino)azetidin-1-yl]pyrimidin-2-amine (PubChem CID 42623888) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is 4-cyclopentyl-6-[3-(methylamino)azetidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-cyclopentyl-6-[3-(methylamino)azetidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 42623888 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 4-cyclopentyl-6-[3-(methylamino)azetidin-1-yl]pyrimidin-2-amine |
| SMILES | CNC1CN(c2cc(C3CCCC3)nc(N)n2)C1 |
| InChI | InChI=1S/C13H21N5/c1-15-10-7-18(8-10)12-6-11(16-13(14)17-12)9-4-2-3-5-9/h6,9-10,15H,2-5,7-8H2,1H3,(H2,14,16,17) |
| InChIKey | CNQQBCXASSPKLI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |