About N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine
N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine (PubChem CID 59777386) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine |
| PubChem CID | 59777386 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine |
| SMILES | CCc1noc(C[C@@H](C)NC(C)(C)C)n1 |
| InChI | InChI=1S/C11H21N3O/c1-6-9-12-10(15-14-9)7-8(2)13-11(3,4)5/h8,13H,6-7H2,1-5H3/t8-/m1/s1 |
| InChIKey | QQWUJOJBKJMMAT-MRVPVSSYSA-N |
| XLogP | 1.95 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine?
The IUPAC name of N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine (CID 59777386) is N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine?
The canonical SMILES for N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine is CCc1noc(C[C@@H](C)NC(C)(C)C)n1.
What is the InChIKey of N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine?
The InChIKey is QQWUJOJBKJMMAT-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-6-9-12-10(15-14-9)7-8(2)13-11(3,4)5/h8,13H,6-7H2,1-5H3/t8-/m1/s1.
What are the key properties of N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine?
N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine has a molecular weight of 211.31 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-1-(3-ethyl-1,2,4-oxadiazol-5-yl)propan-2-yl]-2-methylpropan-2-amine is sourced from PubChem (CID 59777386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).