C26H24F3NO — CID 59777857
(4aS,5R,10bS)-6-benzyl-5-phenyl-9-(trifluoromethyl)-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinoline (PubChem CID 59777857) has the molecular formula C26H24F3NO and a molecular weight of 423.48 g/mol. Its IUPAC name is (4aS,5R,10bS)-6-benzyl-5-phenyl-9-(trifluoromethyl)-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-6-benzyl-5-phenyl-9-(trifluoromethyl)-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 59777857 |
| Molecular Formula | C26H24F3NO |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (4aS,5R,10bS)-6-benzyl-5-phenyl-9-(trifluoromethyl)-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinoline |
| SMILES | FC(F)(F)c1ccc2c(c1)[C@H]1OCCC[C@H]1[C@H](c1ccccc1)N2Cc1ccccc1 |
| InChI | InChI=1S/C26H24F3NO/c27-26(28,29)20-13-14-23-22(16-20)25-21(12-7-15-31-25)24(19-10-5-2-6-11-19)30(23)17-18-8-3-1-4-9-18/h1-6,8-11,13-14,16,21,24-25H,7,12,15,17H2/t21-,24-,25-/m0/s1 |
| InChIKey | TVIRDFDQROHCQW-TUSQITKMSA-N |
| XLogP | 6.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |