C12H18O4 — CID 59779794
(2,3-dioxocyclopentyl)methyl 2,2-dimethylbutanoate (PubChem CID 59779794) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (2,3-dioxocyclopentyl)methyl 2,2-dimethylbutanoate.
| Compound Name | (2,3-dioxocyclopentyl)methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59779794 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (2,3-dioxocyclopentyl)methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1CCC(=O)C1=O |
| InChI | InChI=1S/C12H18O4/c1-4-12(2,3)11(15)16-7-8-5-6-9(13)10(8)14/h8H,4-7H2,1-3H3 |
| InChIKey | RALJFOXIFYNEBN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|