About (5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate
(5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate (PubChem CID 170035479) has the molecular formula C11H15NO5
and a molecular weight of 241.24 g/mol. Its IUPAC name is (5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate.
Analyze (5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate?
The IUPAC name of (5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate (CID 170035479) is (5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate.
What is the SMILES notation for (5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate?
The canonical SMILES for (5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OCC1OC(=O)OC1C#N.
What is the InChIKey of (5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate?
The InChIKey is VUVRMZMMZSVXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO5/c1-4-11(2,3)9(13)15-6-8-7(5-12)16-10(14)17-8/h7-8H,4,6H2,1-3H3.
What are the key properties of (5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate?
(5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate has a molecular weight of 241.24 g/mol, XLogP of 1.39, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-2-oxo-1,3-dioxolan-4-yl)methyl 2,2-dimethylbutanoate is sourced from PubChem (CID 170035479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).