C11H17NO2 — CID 59782249
1-methyl-5-[(2S)-2-methylbutyl]-3-nitrocyclopenta-1,3-diene (PubChem CID 59782249) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-methyl-5-[(2S)-2-methylbutyl]-3-nitrocyclopenta-1,3-diene.
| Compound Name | 1-methyl-5-[(2S)-2-methylbutyl]-3-nitrocyclopenta-1,3-diene |
|---|---|
| PubChem CID | 59782249 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 1-methyl-5-[(2S)-2-methylbutyl]-3-nitrocyclopenta-1,3-diene |
| SMILES | CC[C@H](C)CC1C=C([N+](=O)[O-])C=C1C |
| InChI | InChI=1S/C11H17NO2/c1-4-8(2)5-10-7-11(12(13)14)6-9(10)3/h6-8,10H,4-5H2,1-3H3/t8-,10?/m0/s1 |
| InChIKey | CDWMKTVPMMZEEB-PEHGTWAWSA-N |
| XLogP | 3.16 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|