C12H10N6O10 — CID 10157694
N,N-bis[(2,4-dinitrocyclopenta-2,4-dien-1-yl)methyl]nitramide (PubChem CID 10157694) has the molecular formula C12H10N6O10 and a molecular weight of 398.24 g/mol. Its IUPAC name is N,N-bis[(2,4-dinitrocyclopenta-2,4-dien-1-yl)methyl]nitramide.
| Compound Name | N,N-bis[(2,4-dinitrocyclopenta-2,4-dien-1-yl)methyl]nitramide |
|---|---|
| PubChem CID | 10157694 |
| Molecular Formula | C12H10N6O10 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N,N-bis[(2,4-dinitrocyclopenta-2,4-dien-1-yl)methyl]nitramide |
| SMILES | O=[N+]([O-])C1=CC(CN(CC2C=C([N+](=O)[O-])C=C2[N+](=O)[O-])[N+](=O)[O-])C([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C12H10N6O10/c19-14(20)9-1-7(11(3-9)16(23)24)5-13(18(27)28)6-8-2-10(15(21)22)4-12(8)17(25)26/h1-4,7-8H,5-6H2 |
| InChIKey | HXNJUSAFCWEQRB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 218.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|