C31H38N2O6 — CID 59786026
3-[2-hexoxycarbonyl-5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-3,4-dihydro-1H-isoquinolin-8-yl]propanoic acid (PubChem CID 59786026) has the molecular formula C31H38N2O6 and a molecular weight of 534.65 g/mol. Its IUPAC name is 3-[2-hexoxycarbonyl-5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-3,4-dihydro-1H-isoquinolin-8-yl]propanoic acid.
| Compound Name | 3-[2-hexoxycarbonyl-5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-3,4-dihydro-1H-isoquinolin-8-yl]propanoic acid |
|---|---|
| PubChem CID | 59786026 |
| Molecular Formula | C31H38N2O6 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 3-[2-hexoxycarbonyl-5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]-3,4-dihydro-1H-isoquinolin-8-yl]propanoic acid |
| SMILES | CCCCCCOC(=O)N1CCc2c(OCCc3nc(-c4ccccc4)oc3C)ccc(CCC(=O)O)c2C1 |
| InChI | InChI=1S/C31H38N2O6/c1-3-4-5-9-19-38-31(36)33-18-16-25-26(21-33)23(13-15-29(34)35)12-14-28(25)37-20-17-27-22(2)39-30(32-27)24-10-7-6-8-11-24/h6-8,10-12,14H,3-5,9,13,15-21H2,1-2H3,(H,34,35) |
| InChIKey | MALGHAZWPPPZLI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|