C22H20N4O5S — CID 59786825
N-[[4-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]carbamothioyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 59786825) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is N-[[4-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]carbamothioyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[[4-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]carbamothioyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 59786825 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-[[4-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]carbamothioyl]-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)NC(=S)Nc1ccc(C(=O)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H20N4O5S/c1-12-19(13(2)31-26-12)21(28)25-22(32)24-16-6-4-15(5-7-16)20(27)23-10-14-3-8-17-18(9-14)30-11-29-17/h3-9H,10-11H2,1-2H3,(H,23,27)(H2,24,25,28,32) |
| InChIKey | VLDDRGZBHQBHAW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|