C31H59N11O9 — CID 59787254
6,9,18-tris(2-aminoethyl)-3,12-bis(1-hydroxyethyl)-21-(methylamino)-15-(2-methylpropyl)-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone (PubChem CID 59787254) has the molecular formula C31H59N11O9 and a molecular weight of 729.88 g/mol. Its IUPAC name is 6,9,18-tris(2-aminoethyl)-3,12-bis(1-hydroxyethyl)-21-(methylamino)-15-(2-methylpropyl)-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone.
| Compound Name | 6,9,18-tris(2-aminoethyl)-3,12-bis(1-hydroxyethyl)-21-(methylamino)-15-(2-methylpropyl)-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone |
|---|---|
| PubChem CID | 59787254 |
| Molecular Formula | C31H59N11O9 |
| Molecular Weight | 729.88 g/mol |
| Exact Mass | 729.45 |
| IUPAC Name | 6,9,18-tris(2-aminoethyl)-3,12-bis(1-hydroxyethyl)-21-(methylamino)-15-(2-methylpropyl)-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone |
| SMILES | CNC1CCNC(=O)C(C(C)O)NC(=O)C(CCN)NC(=O)C(CCN)NC(=O)C(C(C)O)NC(=O)C(CC(C)C)NC(=O)C(CCN)NC1=O |
| InChI | InChI=1S/C31H59N11O9/c1-15(2)14-22-29(49)42-24(17(4)44)31(51)39-20(7-11-33)26(46)38-21(8-12-34)28(48)41-23(16(3)43)30(50)36-13-9-18(35-5)25(45)37-19(6-10-32)27(47)40-22/h15-24,35,43-44H,6-14,32-34H2,1-5H3,(H,36,50)(H,37,45)(H,38,46)(H,39,51)(H,40,47)(H,41,48)(H,42,49) |
| InChIKey | GMKPFHVZXBGRPL-UHFFFAOYSA-N |
| XLogP | -6.14 |
| TPSA | 334.25 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.88 |
| LogP ≤ 5 | -6.14 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 13 |