C38H65N11O7 — CID 59787261
6,9,18-tris(2-aminoethyl)-12-benzyl-21-(methylamino)-3,15-bis(2-methylpropyl)-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone (PubChem CID 59787261) has the molecular formula C38H65N11O7 and a molecular weight of 788.01 g/mol. Its IUPAC name is 6,9,18-tris(2-aminoethyl)-12-benzyl-21-(methylamino)-3,15-bis(2-methylpropyl)-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone.
| Compound Name | 6,9,18-tris(2-aminoethyl)-12-benzyl-21-(methylamino)-3,15-bis(2-methylpropyl)-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone |
|---|---|
| PubChem CID | 59787261 |
| Molecular Formula | C38H65N11O7 |
| Molecular Weight | 788.01 g/mol |
| Exact Mass | 787.51 |
| IUPAC Name | 6,9,18-tris(2-aminoethyl)-12-benzyl-21-(methylamino)-3,15-bis(2-methylpropyl)-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone |
| SMILES | CNC1CCNC(=O)C(CC(C)C)NC(=O)C(CCN)NC(=O)C(CCN)NC(=O)C(Cc2ccccc2)NC(=O)C(CC(C)C)NC(=O)C(CCN)NC1=O |
| InChI | InChI=1S/C38H65N11O7/c1-22(2)19-29-32(50)43-18-14-25(42-5)33(51)44-27(12-16-40)36(54)48-30(20-23(3)4)37(55)49-31(21-24-9-7-6-8-10-24)38(56)46-26(11-15-39)34(52)45-28(13-17-41)35(53)47-29/h6-10,22-23,25-31,42H,11-21,39-41H2,1-5H3,(H,43,50)(H,44,51)(H,45,52)(H,46,56)(H,47,53)(H,48,54)(H,49,55) |
| InChIKey | INBRZTHPSBYDAU-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 293.79 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.01 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |