C22H22N6O3S — CID 59789685
N-[6-(4-methylsulfonylphenyl)-2-morpholin-4-ylpyrimidin-4-yl]-1H-indazol-5-amine (PubChem CID 59789685) has the molecular formula C22H22N6O3S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-[6-(4-methylsulfonylphenyl)-2-morpholin-4-ylpyrimidin-4-yl]-1H-indazol-5-amine.
| Compound Name | N-[6-(4-methylsulfonylphenyl)-2-morpholin-4-ylpyrimidin-4-yl]-1H-indazol-5-amine |
|---|---|
| PubChem CID | 59789685 |
| Molecular Formula | C22H22N6O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-[6-(4-methylsulfonylphenyl)-2-morpholin-4-ylpyrimidin-4-yl]-1H-indazol-5-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2cc(Nc3ccc4[nH]ncc4c3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C22H22N6O3S/c1-32(29,30)18-5-2-15(3-6-18)20-13-21(26-22(25-20)28-8-10-31-11-9-28)24-17-4-7-19-16(12-17)14-23-27-19/h2-7,12-14H,8-11H2,1H3,(H,23,27)(H,24,25,26) |
| InChIKey | OEALYNBQWJVSPY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |