C22H20N6O4 — CID 59789728
4-(3-hydroxyphenyl)-6-(1H-indazol-5-ylamino)-2-morpholin-4-ylpyrimidine-5-carboxylic acid (PubChem CID 59789728) has the molecular formula C22H20N6O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is 4-(3-hydroxyphenyl)-6-(1H-indazol-5-ylamino)-2-morpholin-4-ylpyrimidine-5-carboxylic acid.
| Compound Name | 4-(3-hydroxyphenyl)-6-(1H-indazol-5-ylamino)-2-morpholin-4-ylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 59789728 |
| Molecular Formula | C22H20N6O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-(3-hydroxyphenyl)-6-(1H-indazol-5-ylamino)-2-morpholin-4-ylpyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1c(Nc2ccc3[nH]ncc3c2)nc(N2CCOCC2)nc1-c1cccc(O)c1 |
| InChI | InChI=1S/C22H20N6O4/c29-16-3-1-2-13(11-16)19-18(21(30)31)20(26-22(25-19)28-6-8-32-9-7-28)24-15-4-5-17-14(10-15)12-23-27-17/h1-5,10-12,29H,6-9H2,(H,23,27)(H,30,31)(H,24,25,26) |
| InChIKey | MWRHPIPTXCOFEL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |