C23H20ClN7OS — CID 59130336
2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 59130336) has the molecular formula C23H20ClN7OS and a molecular weight of 477.98 g/mol. Its IUPAC name is 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 59130336 |
| Molecular Formula | C23H20ClN7OS |
| Molecular Weight | 477.98 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | Clc1cc(Nc2nc(Nc3ccc4[nH]ncc4c3)c3sccc3n2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C23H20ClN7OS/c24-17-12-16(2-4-20(17)31-6-8-32-9-7-31)27-23-28-19-5-10-33-21(19)22(29-23)26-15-1-3-18-14(11-15)13-25-30-18/h1-5,10-13H,6-9H2,(H,25,30)(H2,26,27,28,29) |
| InChIKey | PBHKWIHPJIOQFN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.98 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|