C22H26N2O4S — CID 59791803
N-[(2S)-1-[(3aR,7aS)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4-methyl-1-oxopentan-2-yl]-1-benzothiophene-3-carboxamide (PubChem CID 59791803) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is N-[(2S)-1-[(3aR,7aS)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4-methyl-1-oxopentan-2-yl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(2S)-1-[(3aR,7aS)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4-methyl-1-oxopentan-2-yl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 59791803 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-[(2S)-1-[(3aR,7aS)-3-oxo-5,6,7,7a-tetrahydro-3aH-furo[3,2-b]pyridin-4-yl]-4-methyl-1-oxopentan-2-yl]-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1csc2ccccc12)C(=O)N1CCC[C@@H]2OCC(=O)[C@@H]21 |
| InChI | InChI=1S/C22H26N2O4S/c1-13(2)10-16(22(27)24-9-5-7-18-20(24)17(25)11-28-18)23-21(26)15-12-29-19-8-4-3-6-14(15)19/h3-4,6,8,12-13,16,18,20H,5,7,9-11H2,1-2H3,(H,23,26)/t16-,18-,20-/m0/s1 |
| InChIKey | XIQZBIOKKYIZOE-QRFRQXIXSA-N |
| XLogP | 3.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |