C8H12N2O3 — CID 597937
5-(methoxymethyl)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 597937) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 5-(methoxymethyl)-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-(methoxymethyl)-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 597937 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-(methoxymethyl)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | COCc1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C8H12N2O3/c1-9-4-6(5-13-3)7(11)10(2)8(9)12/h4H,5H2,1-3H3 |
| InChIKey | KAOMKKGEAAIGEC-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |