C21H18BrF3N2O3S — CID 59799463
methyl 5-(2-amino-4-bromoanilino)-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxylate (PubChem CID 59799463) has the molecular formula C21H18BrF3N2O3S and a molecular weight of 515.35 g/mol. Its IUPAC name is methyl 5-(2-amino-4-bromoanilino)-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxylate.
| Compound Name | methyl 5-(2-amino-4-bromoanilino)-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 59799463 |
| Molecular Formula | C21H18BrF3N2O3S |
| Molecular Weight | 515.35 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | methyl 5-(2-amino-4-bromoanilino)-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(Nc2ccc(Br)cc2N)cc1O[C@H](C)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H18BrF3N2O3S/c1-11(13-5-3-4-6-14(13)21(23,24)25)30-17-10-18(31-19(17)20(28)29-2)27-16-8-7-12(22)9-15(16)26/h3-11,27H,26H2,1-2H3/t11-/m1/s1 |
| InChIKey | AUBBHHZVGNYJAT-LLVKDONJSA-N |
| XLogP | 6.78 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.35 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|