C23H23F3N2O3S — CID 89371825
methyl 5-(2-amino-5-ethylanilino)-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxylate (PubChem CID 89371825) has the molecular formula C23H23F3N2O3S and a molecular weight of 464.51 g/mol. Its IUPAC name is methyl 5-(2-amino-5-ethylanilino)-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxylate.
| Compound Name | methyl 5-(2-amino-5-ethylanilino)-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 89371825 |
| Molecular Formula | C23H23F3N2O3S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | methyl 5-(2-amino-5-ethylanilino)-3-[(1R)-1-[2-(trifluoromethyl)phenyl]ethoxy]thiophene-2-carboxylate |
| SMILES | CCc1ccc(N)c(Nc2cc(O[C@H](C)c3ccccc3C(F)(F)F)c(C(=O)OC)s2)c1 |
| InChI | InChI=1S/C23H23F3N2O3S/c1-4-14-9-10-17(27)18(11-14)28-20-12-19(21(32-20)22(29)30-3)31-13(2)15-7-5-6-8-16(15)23(24,25)26/h5-13,28H,4,27H2,1-3H3/t13-/m1/s1 |
| InChIKey | ARSFSKGRGSMDKD-CYBMUJFWSA-N |
| XLogP | 6.58 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|