C19H16IN5O — CID 59799879
3-(imidazol-1-ylmethyl)-5-(4-iodophenyl)-4-(4-methoxyphenyl)-1,2,4-triazole (PubChem CID 59799879) has the molecular formula C19H16IN5O and a molecular weight of 457.28 g/mol. Its IUPAC name is 3-(imidazol-1-ylmethyl)-5-(4-iodophenyl)-4-(4-methoxyphenyl)-1,2,4-triazole.
| Compound Name | 3-(imidazol-1-ylmethyl)-5-(4-iodophenyl)-4-(4-methoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 59799879 |
| Molecular Formula | C19H16IN5O |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 3-(imidazol-1-ylmethyl)-5-(4-iodophenyl)-4-(4-methoxyphenyl)-1,2,4-triazole |
| SMILES | COc1ccc(-n2c(Cn3ccnc3)nnc2-c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C19H16IN5O/c1-26-17-8-6-16(7-9-17)25-18(12-24-11-10-21-13-24)22-23-19(25)14-2-4-15(20)5-3-14/h2-11,13H,12H2,1H3 |
| InChIKey | BCTUGXUGCNLOPD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|