C29H22N2O2 — CID 59800367
2,5-dimethyl-4-(3-methylnaphthalen-2-yl)-1-naphthalen-1-ylpyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 59800367) has the molecular formula C29H22N2O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2,5-dimethyl-4-(3-methylnaphthalen-2-yl)-1-naphthalen-1-ylpyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-dimethyl-4-(3-methylnaphthalen-2-yl)-1-naphthalen-1-ylpyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 59800367 |
| Molecular Formula | C29H22N2O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2,5-dimethyl-4-(3-methylnaphthalen-2-yl)-1-naphthalen-1-ylpyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | Cc1cc2ccccc2cc1C1=C2C(=O)N(C)C(c3cccc4ccccc34)=C2C(=O)N1C |
| InChI | InChI=1S/C29H22N2O2/c1-17-15-19-10-4-5-11-20(19)16-23(17)27-25-24(28(32)31(27)3)26(30(2)29(25)33)22-14-8-12-18-9-6-7-13-21(18)22/h4-16H,1-3H3 |
| InChIKey | HBOUBMRURHWMJM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|