C61H42N2O4 — CID 71211540
1,4-bis[2-methoxy-5-(4-naphthalen-1-ylnaphthalen-1-yl)phenyl]-5-methyl-2H-pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 71211540) has the molecular formula C61H42N2O4 and a molecular weight of 867.02 g/mol. Its IUPAC name is 1,4-bis[2-methoxy-5-(4-naphthalen-1-ylnaphthalen-1-yl)phenyl]-5-methyl-2H-pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-bis[2-methoxy-5-(4-naphthalen-1-ylnaphthalen-1-yl)phenyl]-5-methyl-2H-pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 71211540 |
| Molecular Formula | C61H42N2O4 |
| Molecular Weight | 867.02 g/mol |
| Exact Mass | 866.31 |
| IUPAC Name | 1,4-bis[2-methoxy-5-(4-naphthalen-1-ylnaphthalen-1-yl)phenyl]-5-methyl-2H-pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | COc1ccc(-c2ccc(-c3cccc4ccccc34)c3ccccc23)cc1C1=C2C(=O)N(C)C(c3cc(-c4ccc(-c5cccc6ccccc56)c5ccccc45)ccc3OC)=C2C(=O)N1 |
| InChI | InChI=1S/C61H42N2O4/c1-63-59(53-35-39(27-33-55(53)67-3)43-29-31-51(49-23-11-9-21-45(43)49)47-25-13-17-37-15-5-7-19-41(37)47)57-56(61(63)65)58(62-60(57)64)52-34-38(26-32-54(52)66-2)42-28-30-50(48-22-10-8-20-44(42)48)46-24-12-16-36-14-4-6-18-40(36)46/h4-35H,1-3H3,(H,62,64) |
| InChIKey | MBLPRNJRRSTDKT-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.02 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|