C38H36Br2F2N2 — CID 59800413
1-N,4-N-bis(4-bromophenyl)-1-N,4-N-bis(4-butylphenyl)-2,5-difluorobenzene-1,4-diamine (PubChem CID 59800413) has the molecular formula C38H36Br2F2N2 and a molecular weight of 718.52 g/mol. Its IUPAC name is 1-N,4-N-bis(4-bromophenyl)-1-N,4-N-bis(4-butylphenyl)-2,5-difluorobenzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(4-bromophenyl)-1-N,4-N-bis(4-butylphenyl)-2,5-difluorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 59800413 |
| Molecular Formula | C38H36Br2F2N2 |
| Molecular Weight | 718.52 g/mol |
| Exact Mass | 716.12 |
| IUPAC Name | 1-N,4-N-bis(4-bromophenyl)-1-N,4-N-bis(4-butylphenyl)-2,5-difluorobenzene-1,4-diamine |
| SMILES | CCCCc1ccc(N(c2ccc(Br)cc2)c2cc(F)c(N(c3ccc(Br)cc3)c3ccc(CCCC)cc3)cc2F)cc1 |
| InChI | InChI=1S/C38H36Br2F2N2/c1-3-5-7-27-9-17-31(18-10-27)43(33-21-13-29(39)14-22-33)37-25-36(42)38(26-35(37)41)44(34-23-15-30(40)16-24-34)32-19-11-28(12-20-32)8-6-4-2/h9-26H,3-8H2,1-2H3 |
| InChIKey | VTISJSIWHHDKER-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.52 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |