C30H37N3O4 — CID 59800726
1-[(4-methoxyphenyl)methyl]-3-[3-nitro-2,6-di(propan-2-yl)phenyl]-1-(4-propan-2-ylphenyl)urea (PubChem CID 59800726) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[3-nitro-2,6-di(propan-2-yl)phenyl]-1-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[3-nitro-2,6-di(propan-2-yl)phenyl]-1-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 59800726 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[3-nitro-2,6-di(propan-2-yl)phenyl]-1-(4-propan-2-ylphenyl)urea |
| SMILES | COc1ccc(CN(C(=O)Nc2c(C(C)C)ccc([N+](=O)[O-])c2C(C)C)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H37N3O4/c1-19(2)23-10-12-24(13-11-23)32(18-22-8-14-25(37-7)15-9-22)30(34)31-29-26(20(3)4)16-17-27(33(35)36)28(29)21(5)6/h8-17,19-21H,18H2,1-7H3,(H,31,34) |
| InChIKey | FEQIZKYBYBYZCD-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|