C30H39N3O2 — CID 12003039
3-[3-amino-2,6-di(propan-2-yl)phenyl]-1-[(4-methoxyphenyl)methyl]-1-(4-propan-2-ylphenyl)urea (PubChem CID 12003039) has the molecular formula C30H39N3O2 and a molecular weight of 473.66 g/mol. Its IUPAC name is 3-[3-amino-2,6-di(propan-2-yl)phenyl]-1-[(4-methoxyphenyl)methyl]-1-(4-propan-2-ylphenyl)urea.
| Compound Name | 3-[3-amino-2,6-di(propan-2-yl)phenyl]-1-[(4-methoxyphenyl)methyl]-1-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 12003039 |
| Molecular Formula | C30H39N3O2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | 3-[3-amino-2,6-di(propan-2-yl)phenyl]-1-[(4-methoxyphenyl)methyl]-1-(4-propan-2-ylphenyl)urea |
| SMILES | COc1ccc(CN(C(=O)Nc2c(C(C)C)ccc(N)c2C(C)C)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H39N3O2/c1-19(2)23-10-12-24(13-11-23)33(18-22-8-14-25(35-7)15-9-22)30(34)32-29-26(20(3)4)16-17-27(31)28(29)21(5)6/h8-17,19-21H,18,31H2,1-7H3,(H,32,34) |
| InChIKey | ZKRIJFYJADHTLP-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|