C28H35N3O — CID 12003387
3-(3-amino-2,6-diethylphenyl)-1-(2-phenylethyl)-1-(4-propan-2-ylphenyl)urea (PubChem CID 12003387) has the molecular formula C28H35N3O and a molecular weight of 429.61 g/mol. Its IUPAC name is 3-(3-amino-2,6-diethylphenyl)-1-(2-phenylethyl)-1-(4-propan-2-ylphenyl)urea.
| Compound Name | 3-(3-amino-2,6-diethylphenyl)-1-(2-phenylethyl)-1-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 12003387 |
| Molecular Formula | C28H35N3O |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | 3-(3-amino-2,6-diethylphenyl)-1-(2-phenylethyl)-1-(4-propan-2-ylphenyl)urea |
| SMILES | CCc1ccc(N)c(CC)c1NC(=O)N(CCc1ccccc1)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C28H35N3O/c1-5-22-14-17-26(29)25(6-2)27(22)30-28(32)31(19-18-21-10-8-7-9-11-21)24-15-12-23(13-16-24)20(3)4/h7-17,20H,5-6,18-19,29H2,1-4H3,(H,30,32) |
| InChIKey | WIBKEGFRFOQDCX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|