C23H20N4O3 — CID 59802969
N-[[2-(2-amino-3,4-dioxocyclobuten-1-yl)-3,4-dihydro-1H-isoquinolin-7-yl]methyl]-1H-indole-2-carboxamide (PubChem CID 59802969) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is N-[[2-(2-amino-3,4-dioxocyclobuten-1-yl)-3,4-dihydro-1H-isoquinolin-7-yl]methyl]-1H-indole-2-carboxamide.
| Compound Name | N-[[2-(2-amino-3,4-dioxocyclobuten-1-yl)-3,4-dihydro-1H-isoquinolin-7-yl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 59802969 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[[2-(2-amino-3,4-dioxocyclobuten-1-yl)-3,4-dihydro-1H-isoquinolin-7-yl]methyl]-1H-indole-2-carboxamide |
| SMILES | Nc1c(N2CCc3ccc(CNC(=O)c4cc5ccccc5[nH]4)cc3C2)c(=O)c1=O |
| InChI | InChI=1S/C23H20N4O3/c24-19-20(22(29)21(19)28)27-8-7-14-6-5-13(9-16(14)12-27)11-25-23(30)18-10-15-3-1-2-4-17(15)26-18/h1-6,9-10,26H,7-8,11-12,24H2,(H,25,30) |
| InChIKey | WSVMYTDUWUUWEN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|