C22H24N2O2 — CID 59803177
(1R)-1-(3-methoxyphenyl)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]ethanamine (PubChem CID 59803177) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (1R)-1-(3-methoxyphenyl)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]ethanamine.
| Compound Name | (1R)-1-(3-methoxyphenyl)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 59803177 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (1R)-1-(3-methoxyphenyl)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]ethanamine |
| SMILES | COc1cccc([C@@H](C)NCc2cccc(OCc3ccccn3)c2)c1 |
| InChI | InChI=1S/C22H24N2O2/c1-17(19-8-6-10-21(14-19)25-2)24-15-18-7-5-11-22(13-18)26-16-20-9-3-4-12-23-20/h3-14,17,24H,15-16H2,1-2H3/t17-/m1/s1 |
| InChIKey | GZSLTRDZOOSGGJ-QGZVFWFLSA-N |
| XLogP | 4.52 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |