C22H27N5O — CID 95282173
(1R)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanamine (PubChem CID 95282173) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is (1R)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanamine.
| Compound Name | (1R)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanamine |
|---|---|
| PubChem CID | 95282173 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (1R)-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethanamine |
| SMILES | C[C@@H](NCc1cccc(OCc2ccccn2)c1)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C22H27N5O/c1-17(22-26-25-21-11-3-2-6-13-27(21)22)24-15-18-8-7-10-20(14-18)28-16-19-9-4-5-12-23-19/h4-5,7-10,12,14,17,24H,2-3,6,11,13,15-16H2,1H3/t17-/m1/s1 |
| InChIKey | RYBJICUSKUMMIC-QGZVFWFLSA-N |
| XLogP | 3.83 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |