C20H23N5O — CID 86772885
3-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 86772885) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 3-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | 3-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 86772885 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-methyl-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | Cc1nnc2n1CC(NCc1cccc(OCc3ccccn3)c1)CC2 |
| InChI | InChI=1S/C20H23N5O/c1-15-23-24-20-9-8-17(13-25(15)20)22-12-16-5-4-7-19(11-16)26-14-18-6-2-3-10-21-18/h2-7,10-11,17,22H,8-9,12-14H2,1H3 |
| InChIKey | BXLYUPKFVXYBCV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |