C23H25N5O — CID 119126415
2-[[3-[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methyl]phenoxy]methyl]benzonitrile (PubChem CID 119126415) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[[3-[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[3-[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 119126415 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-[[3-[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]methyl]phenoxy]methyl]benzonitrile |
| SMILES | CCc1nc2n(n1)CC(NCc1cccc(OCc3ccccc3C#N)c1)CC2 |
| InChI | InChI=1S/C23H25N5O/c1-2-22-26-23-11-10-20(15-28(23)27-22)25-14-17-6-5-9-21(12-17)29-16-19-8-4-3-7-18(19)13-24/h3-9,12,20,25H,2,10-11,14-16H2,1H3 |
| InChIKey | WRYRHWXUQATZGE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |