C15H18N6OS — CID 95329111
N-(3-cyanothiophen-2-yl)-2-[[(6R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetamide (PubChem CID 95329111) has the molecular formula C15H18N6OS and a molecular weight of 330.42 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[[(6R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[[(6R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetamide |
|---|---|
| PubChem CID | 95329111 |
| Molecular Formula | C15H18N6OS |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[[(6R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetamide |
| SMILES | CCc1nc2n(n1)C[C@H](NCC(=O)Nc1sccc1C#N)CC2 |
| InChI | InChI=1S/C15H18N6OS/c1-2-12-18-13-4-3-11(9-21(13)20-12)17-8-14(22)19-15-10(7-16)5-6-23-15/h5-6,11,17H,2-4,8-9H2,1H3,(H,19,22)/t11-/m1/s1 |
| InChIKey | SOAUYZFOPMBKIO-LLVKDONJSA-N |
| XLogP | 1.32 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |