C23H15F2N5O — CID 59803857
3-[[4-(1H-benzimidazol-2-ylmethoxy)-2,5-difluorophenyl]methyl]-5-isocyano-1H-pyrrolo[2,3-b]pyridine (PubChem CID 59803857) has the molecular formula C23H15F2N5O and a molecular weight of 415.40 g/mol. Its IUPAC name is 3-[[4-(1H-benzimidazol-2-ylmethoxy)-2,5-difluorophenyl]methyl]-5-isocyano-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[[4-(1H-benzimidazol-2-ylmethoxy)-2,5-difluorophenyl]methyl]-5-isocyano-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 59803857 |
| Molecular Formula | C23H15F2N5O |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 3-[[4-(1H-benzimidazol-2-ylmethoxy)-2,5-difluorophenyl]methyl]-5-isocyano-1H-pyrrolo[2,3-b]pyridine |
| SMILES | [C-]#[N+]c1cnc2[nH]cc(Cc3cc(F)c(OCc4nc5ccccc5[nH]4)cc3F)c2c1 |
| InChI | InChI=1S/C23H15F2N5O/c1-26-15-8-16-14(10-27-23(16)28-11-15)6-13-7-18(25)21(9-17(13)24)31-12-22-29-19-4-2-3-5-20(19)30-22/h2-5,7-11H,6,12H2,(H,27,28)(H,29,30) |
| InChIKey | GXLWFXFKBSVPCQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|