C32H42N4O2 — CID 59808312
(2S)-1-(4-benzylpiperazin-1-yl)-2-[[4-[3-(dimethylamino)propoxy]phenyl]methylamino]-3-phenylpropan-1-one (PubChem CID 59808312) has the molecular formula C32H42N4O2 and a molecular weight of 514.71 g/mol. Its IUPAC name is (2S)-1-(4-benzylpiperazin-1-yl)-2-[[4-[3-(dimethylamino)propoxy]phenyl]methylamino]-3-phenylpropan-1-one.
| Compound Name | (2S)-1-(4-benzylpiperazin-1-yl)-2-[[4-[3-(dimethylamino)propoxy]phenyl]methylamino]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 59808312 |
| Molecular Formula | C32H42N4O2 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | (2S)-1-(4-benzylpiperazin-1-yl)-2-[[4-[3-(dimethylamino)propoxy]phenyl]methylamino]-3-phenylpropan-1-one |
| SMILES | CN(C)CCCOc1ccc(CN[C@@H](Cc2ccccc2)C(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H42N4O2/c1-34(2)18-9-23-38-30-16-14-28(15-17-30)25-33-31(24-27-10-5-3-6-11-27)32(37)36-21-19-35(20-22-36)26-29-12-7-4-8-13-29/h3-8,10-17,31,33H,9,18-26H2,1-2H3/t31-/m0/s1 |
| InChIKey | BNMLYPKGILICOI-HKBQPEDESA-N |
| XLogP | 4.06 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|