C18H20N3Y- — CID 59808759
2-benzyl-1-butyl-4-methyl-6H-imidazo[4,5-c]pyridin-6-ide;yttrium (PubChem CID 59808759) has the molecular formula C18H20N3Y- and a molecular weight of 367.29 g/mol. Its IUPAC name is 2-benzyl-1-butyl-4-methyl-6H-imidazo[4,5-c]pyridin-6-ide;yttrium.
| Compound Name | 2-benzyl-1-butyl-4-methyl-6H-imidazo[4,5-c]pyridin-6-ide;yttrium |
|---|---|
| PubChem CID | 59808759 |
| Molecular Formula | C18H20N3Y- |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-benzyl-1-butyl-4-methyl-6H-imidazo[4,5-c]pyridin-6-ide;yttrium |
| SMILES | CCCCn1c(Cc2ccccc2)nc2c(C)n[c-]cc21.[Y] |
| InChI | InChI=1S/C18H20N3.Y/c1-3-4-12-21-16-10-11-19-14(2)18(16)20-17(21)13-15-8-6-5-7-9-15;/h5-10H,3-4,12-13H2,1-2H3;/q-1; |
| InChIKey | UUPBHUGFIXJEMM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|