C17H23N — CID 10681586
5-benzyl-1-butyl-2,3-dimethylpyrrole (PubChem CID 10681586) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 5-benzyl-1-butyl-2,3-dimethylpyrrole.
| Compound Name | 5-benzyl-1-butyl-2,3-dimethylpyrrole |
|---|---|
| PubChem CID | 10681586 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 5-benzyl-1-butyl-2,3-dimethylpyrrole |
| SMILES | CCCCn1c(Cc2ccccc2)cc(C)c1C |
| InChI | InChI=1S/C17H23N/c1-4-5-11-18-15(3)14(2)12-17(18)13-16-9-7-6-8-10-16/h6-10,12H,4-5,11,13H2,1-3H3 |
| InChIKey | WIZBYCKQCMUWHK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |