About methylbenzene;4-methylbenzene-6-id-1-amine;yttrium
methylbenzene;4-methylbenzene-6-id-1-amine;yttrium (PubChem CID 59809545) has the molecular formula C14H15NY-2
and a molecular weight of 286.19 g/mol. Its IUPAC name is methylbenzene;4-methylbenzene-6-id-1-amine;yttrium.
Molecular Properties
| Compound Name | methylbenzene;4-methylbenzene-6-id-1-amine;yttrium |
| PubChem CID | 59809545 |
| Molecular Formula | C14H15NY-2 |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | methylbenzene;4-methylbenzene-6-id-1-amine;yttrium |
| SMILES | Cc1[c-]cccc1.Cc1c[c-]c(N)cc1.[Y] |
| InChI | InChI=1S/C7H8N.C7H7.Y/c1-6-2-4-7(8)5-3-6;1-7-5-3-2-4-6-7;/h2-4H,8H2,1H3;2-5H,1H3;/q2*-1; |
| InChIKey | AVSPTWCIKYGEFD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methylbenzene;4-methylbenzene-6-id-1-amine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylbenzene;4-methylbenzene-6-id-1-amine;yttrium?
The IUPAC name of methylbenzene;4-methylbenzene-6-id-1-amine;yttrium (CID 59809545) is methylbenzene;4-methylbenzene-6-id-1-amine;yttrium.
What is the SMILES notation for methylbenzene;4-methylbenzene-6-id-1-amine;yttrium?
The canonical SMILES for methylbenzene;4-methylbenzene-6-id-1-amine;yttrium is Cc1[c-]cccc1.Cc1c[c-]c(N)cc1.[Y].
What is the InChIKey of methylbenzene;4-methylbenzene-6-id-1-amine;yttrium?
The InChIKey is AVSPTWCIKYGEFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N.C7H7.Y/c1-6-2-4-7(8)5-3-6;1-7-5-3-2-4-6-7;/h2-4H,8H2,1H3;2-5H,1H3;/q2*-1;.
What are the key properties of methylbenzene;4-methylbenzene-6-id-1-amine;yttrium?
methylbenzene;4-methylbenzene-6-id-1-amine;yttrium has a molecular weight of 286.19 g/mol, XLogP of 3.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylbenzene;4-methylbenzene-6-id-1-amine;yttrium is sourced from PubChem (CID 59809545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).