C22H17N7O — CID 59812110
4-[3-(1H-pyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N'-pyridin-2-ylbenzohydrazide (PubChem CID 59812110) has the molecular formula C22H17N7O and a molecular weight of 395.43 g/mol. Its IUPAC name is 4-[3-(1H-pyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N'-pyridin-2-ylbenzohydrazide.
| Compound Name | 4-[3-(1H-pyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N'-pyridin-2-ylbenzohydrazide |
|---|---|
| PubChem CID | 59812110 |
| Molecular Formula | C22H17N7O |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-[3-(1H-pyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N'-pyridin-2-ylbenzohydrazide |
| SMILES | O=C(NNc1ccccn1)c1ccc(-c2cnc3[nH]cc(-c4cn[nH]c4)c3c2)cc1 |
| InChI | InChI=1S/C22H17N7O/c30-22(29-28-20-3-1-2-8-23-20)15-6-4-14(5-7-15)16-9-18-19(17-11-26-27-12-17)13-25-21(18)24-10-16/h1-13H,(H,23,28)(H,24,25)(H,26,27)(H,29,30) |
| InChIKey | QYLPKVOCPHDYAK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|