C11H21NO — CID 59815013
1,4-di(propan-2-yl)piperidin-2-one (PubChem CID 59815013) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 1,4-di(propan-2-yl)piperidin-2-one.
| Compound Name | 1,4-di(propan-2-yl)piperidin-2-one |
|---|---|
| PubChem CID | 59815013 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1,4-di(propan-2-yl)piperidin-2-one |
| SMILES | CC(C)C1CCN(C(C)C)C(=O)C1 |
| InChI | InChI=1S/C11H21NO/c1-8(2)10-5-6-12(9(3)4)11(13)7-10/h8-10H,5-7H2,1-4H3 |
| InChIKey | BNWWRHIBURTCRV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |