C37H34F2O10S — CID 59816715
[4-[4-[2-fluoro-4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]sulfonylphenyl] 4-butoxy-2-fluorobenzoate (PubChem CID 59816715) has the molecular formula C37H34F2O10S and a molecular weight of 708.73 g/mol. Its IUPAC name is [4-[4-[2-fluoro-4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]sulfonylphenyl] 4-butoxy-2-fluorobenzoate.
| Compound Name | [4-[4-[2-fluoro-4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]sulfonylphenyl] 4-butoxy-2-fluorobenzoate |
|---|---|
| PubChem CID | 59816715 |
| Molecular Formula | C37H34F2O10S |
| Molecular Weight | 708.73 g/mol |
| Exact Mass | 708.18 |
| IUPAC Name | [4-[4-[2-fluoro-4-(4-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl]sulfonylphenyl] 4-butoxy-2-fluorobenzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(S(=O)(=O)c3ccc(OC(=O)c4ccc(OCCCC)cc4F)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C37H34F2O10S/c1-3-5-20-45-27-12-18-31(33(38)23-27)36(41)48-25-8-14-29(15-9-25)50(43,44)30-16-10-26(11-17-30)49-37(42)32-19-13-28(24-34(32)39)46-21-6-7-22-47-35(40)4-2/h4,8-19,23-24H,2-3,5-7,20-22H2,1H3 |
| InChIKey | DMAROJRLDZEMPA-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.73 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|