C12H10BrNO5 — CID 598169
(2-bromophenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 598169) has the molecular formula C12H10BrNO5 and a molecular weight of 328.12 g/mol. Its IUPAC name is (2-bromophenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | (2-bromophenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 598169 |
| Molecular Formula | C12H10BrNO5 |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | (2-bromophenyl)methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | O=C(OCc1ccccc1Br)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H10BrNO5/c13-9-4-2-1-3-8(9)7-18-12(17)19-14-10(15)5-6-11(14)16/h1-4H,5-7H2 |
| InChIKey | SZDNRTVADOCWKU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|