C10H17N2O4W- — CID 59817685
4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-ide-2-carboxylic acid;tungsten (PubChem CID 59817685) has the molecular formula C10H17N2O4W- and a molecular weight of 413.10 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-ide-2-carboxylic acid;tungsten.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-ide-2-carboxylic acid;tungsten |
|---|---|
| PubChem CID | 59817685 |
| Molecular Formula | C10H17N2O4W- |
| Molecular Weight | 413.10 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-ide-2-carboxylic acid;tungsten |
| SMILES | CC(C)(C)OC(=O)N1CC[N-]C(C(=O)O)C1.[W] |
| InChI | InChI=1S/C10H17N2O4.W/c1-10(2,3)16-9(15)12-5-4-11-7(6-12)8(13)14;/h7H,4-6H2,1-3H3,(H,13,14);/q-1; |
| InChIKey | NLAZPHQESXPWJX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.10 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |