C42H44Cl3N5O5 — CID 59819265
3-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]-2-oxopropyl]-N-[4-[(4-methoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide (PubChem CID 59819265) has the molecular formula C42H44Cl3N5O5 and a molecular weight of 805.20 g/mol. Its IUPAC name is 3-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]-2-oxopropyl]-N-[4-[(4-methoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide.
| Compound Name | 3-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]-2-oxopropyl]-N-[4-[(4-methoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 59819265 |
| Molecular Formula | C42H44Cl3N5O5 |
| Molecular Weight | 805.20 g/mol |
| Exact Mass | 803.24 |
| IUPAC Name | 3-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]-2-oxopropyl]-N-[4-[(4-methoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]benzamide |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)Cc2cccc(C(=O)NC3=NN(c4c(Cl)cc(Cl)cc4Cl)C(=O)C3/N=N/c3ccc(OC)cc3)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C42H44Cl3N5O5/c1-8-41(3,4)27-13-18-35(32(21-27)42(5,6)9-2)55-24-30(51)20-25-11-10-12-26(19-25)39(52)46-38-36(48-47-29-14-16-31(54-7)17-15-29)40(53)50(49-38)37-33(44)22-28(43)23-34(37)45/h10-19,21-23,36H,8-9,20,24H2,1-7H3,(H,46,49,52)/b48-47+ |
| InChIKey | QQHMWNUZOBQNAK-QJGAVIKSSA-N |
| XLogP | 10.46 |
| TPSA | 122.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.20 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|