C41H45Cl3N6O5 — CID 22955761
N-[1-amino-2-[(4-methoxyphenyl)diazenyl]-3-oxo-3-(2,4,6-trichloroanilino)propylidene]-3-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]benzamide (PubChem CID 22955761) has the molecular formula C41H45Cl3N6O5 and a molecular weight of 808.21 g/mol. Its IUPAC name is N-[1-amino-2-[(4-methoxyphenyl)diazenyl]-3-oxo-3-(2,4,6-trichloroanilino)propylidene]-3-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]benzamide.
| Compound Name | N-[1-amino-2-[(4-methoxyphenyl)diazenyl]-3-oxo-3-(2,4,6-trichloroanilino)propylidene]-3-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 22955761 |
| Molecular Formula | C41H45Cl3N6O5 |
| Molecular Weight | 808.21 g/mol |
| Exact Mass | 806.25 |
| IUPAC Name | N-[1-amino-2-[(4-methoxyphenyl)diazenyl]-3-oxo-3-(2,4,6-trichloroanilino)propylidene]-3-[[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetyl]amino]benzamide |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)Nc2cccc(C(=O)/N=C(\N)C(/N=N/c3ccc(OC)cc3)C(=O)Nc3c(Cl)cc(Cl)cc3Cl)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C41H45Cl3N6O5/c1-8-40(3,4)25-13-18-33(30(20-25)41(5,6)9-2)55-23-34(51)46-28-12-10-11-24(19-28)38(52)48-37(45)36(50-49-27-14-16-29(54-7)17-15-27)39(53)47-35-31(43)21-26(42)22-32(35)44/h10-22,36H,8-9,23H2,1-7H3,(H,46,51)(H,47,53)(H2,45,48,52)/b50-49+ |
| InChIKey | BBOVNSXATJQCDH-BNEIJSFPSA-N |
| XLogP | 10.34 |
| TPSA | 156.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.21 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|