C16H17NO4 — CID 59819841
N-(3-methylphenyl)-3-(2,3,4-trihydroxyphenyl)propanamide (PubChem CID 59819841) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is N-(3-methylphenyl)-3-(2,3,4-trihydroxyphenyl)propanamide.
| Compound Name | N-(3-methylphenyl)-3-(2,3,4-trihydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 59819841 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-(3-methylphenyl)-3-(2,3,4-trihydroxyphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)CCc2ccc(O)c(O)c2O)c1 |
| InChI | InChI=1S/C16H17NO4/c1-10-3-2-4-12(9-10)17-14(19)8-6-11-5-7-13(18)16(21)15(11)20/h2-5,7,9,18,20-21H,6,8H2,1H3,(H,17,19) |
| InChIKey | BOZSBCIHCBZDOR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|