C16H14N2O7 — CID 59594858
3-[3-(2,3-dihydroxy-4-nitrophenyl)propanoylamino]benzoic acid (PubChem CID 59594858) has the molecular formula C16H14N2O7 and a molecular weight of 346.30 g/mol. Its IUPAC name is 3-[3-(2,3-dihydroxy-4-nitrophenyl)propanoylamino]benzoic acid.
| Compound Name | 3-[3-(2,3-dihydroxy-4-nitrophenyl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 59594858 |
| Molecular Formula | C16H14N2O7 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3-[3-(2,3-dihydroxy-4-nitrophenyl)propanoylamino]benzoic acid |
| SMILES | O=C(CCc1ccc([N+](=O)[O-])c(O)c1O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H14N2O7/c19-13(17-11-3-1-2-10(8-11)16(22)23)7-5-9-4-6-12(18(24)25)15(21)14(9)20/h1-4,6,8,20-21H,5,7H2,(H,17,19)(H,22,23) |
| InChIKey | GQVGTXRDWCHCFU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|