C23H20ClN3O3S — CID 59821102
3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[6-(3-oxopropyl)benzimidazol-1-yl]thiophene-2-carboxamide (PubChem CID 59821102) has the molecular formula C23H20ClN3O3S and a molecular weight of 453.95 g/mol. Its IUPAC name is 3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[6-(3-oxopropyl)benzimidazol-1-yl]thiophene-2-carboxamide.
| Compound Name | 3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[6-(3-oxopropyl)benzimidazol-1-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59821102 |
| Molecular Formula | C23H20ClN3O3S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 3-[(1R)-1-(2-chlorophenyl)ethoxy]-5-[6-(3-oxopropyl)benzimidazol-1-yl]thiophene-2-carboxamide |
| SMILES | C[C@@H](Oc1cc(-n2cnc3ccc(CCC=O)cc32)sc1C(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H20ClN3O3S/c1-14(16-6-2-3-7-17(16)24)30-20-12-21(31-22(20)23(25)29)27-13-26-18-9-8-15(5-4-10-28)11-19(18)27/h2-3,6-14H,4-5H2,1H3,(H2,25,29)/t14-/m1/s1 |
| InChIKey | AKLBISYOTQLZHK-CQSZACIVSA-N |
| XLogP | 5.11 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|