C28H31ClN4O4S — CID 59821152
tert-butyl 3-[[3-[5-carbamoyl-4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]benzimidazol-5-yl]methylamino]propanoate (PubChem CID 59821152) has the molecular formula C28H31ClN4O4S and a molecular weight of 555.10 g/mol. Its IUPAC name is tert-butyl 3-[[3-[5-carbamoyl-4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]benzimidazol-5-yl]methylamino]propanoate.
| Compound Name | tert-butyl 3-[[3-[5-carbamoyl-4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]benzimidazol-5-yl]methylamino]propanoate |
|---|---|
| PubChem CID | 59821152 |
| Molecular Formula | C28H31ClN4O4S |
| Molecular Weight | 555.10 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | tert-butyl 3-[[3-[5-carbamoyl-4-[(1R)-1-(2-chlorophenyl)ethoxy]thiophen-2-yl]benzimidazol-5-yl]methylamino]propanoate |
| SMILES | C[C@@H](Oc1cc(-n2cnc3ccc(CNCCC(=O)OC(C)(C)C)cc32)sc1C(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C28H31ClN4O4S/c1-17(19-7-5-6-8-20(19)29)36-23-14-24(38-26(23)27(30)35)33-16-32-21-10-9-18(13-22(21)33)15-31-12-11-25(34)37-28(2,3)4/h5-10,13-14,16-17,31H,11-12,15H2,1-4H3,(H2,30,35)/t17-/m1/s1 |
| InChIKey | VDTLEXABJITNGF-QGZVFWFLSA-N |
| XLogP | 5.80 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.10 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|