C28H33ClN5O3PS — CID 143424795
tert-butyl N-[2-[[3-[5-carbamoyl-4-[1-(2-chlorophenyl)ethylphosphanyl]thiophen-2-yl]benzimidazol-5-yl]methylamino]ethyl]carbamate (PubChem CID 143424795) has the molecular formula C28H33ClN5O3PS and a molecular weight of 586.10 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[5-carbamoyl-4-[1-(2-chlorophenyl)ethylphosphanyl]thiophen-2-yl]benzimidazol-5-yl]methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[5-carbamoyl-4-[1-(2-chlorophenyl)ethylphosphanyl]thiophen-2-yl]benzimidazol-5-yl]methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 143424795 |
| Molecular Formula | C28H33ClN5O3PS |
| Molecular Weight | 586.10 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | tert-butyl N-[2-[[3-[5-carbamoyl-4-[1-(2-chlorophenyl)ethylphosphanyl]thiophen-2-yl]benzimidazol-5-yl]methylamino]ethyl]carbamate |
| SMILES | CC(Pc1cc(-n2cnc3ccc(CNCCNC(=O)OC(C)(C)C)cc32)sc1C(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C28H33ClN5O3PS/c1-17(19-7-5-6-8-20(19)29)38-23-14-24(39-25(23)26(30)35)34-16-33-21-10-9-18(13-22(21)34)15-31-11-12-32-27(36)37-28(2,3)4/h5-10,13-14,16-17,31,38H,11-12,15H2,1-4H3,(H2,30,35)(H,32,36) |
| InChIKey | GTXMCVYKKHQYSB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.10 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|