C29H33ClF3N4O4PS — CID 143424787
3-[(4E,6Z)-4-chloro-3-methylnona-4,6,8-trien-2-yl]phosphanyl-5-[6-[2-(1-oxopropan-2-ylamino)ethyl]benzimidazol-1-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 143424787) has the molecular formula C29H33ClF3N4O4PS and a molecular weight of 657.10 g/mol. Its IUPAC name is 3-[(4E,6Z)-4-chloro-3-methylnona-4,6,8-trien-2-yl]phosphanyl-5-[6-[2-(1-oxopropan-2-ylamino)ethyl]benzimidazol-1-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(4E,6Z)-4-chloro-3-methylnona-4,6,8-trien-2-yl]phosphanyl-5-[6-[2-(1-oxopropan-2-ylamino)ethyl]benzimidazol-1-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 143424787 |
| Molecular Formula | C29H33ClF3N4O4PS |
| Molecular Weight | 657.10 g/mol |
| Exact Mass | 656.16 |
| IUPAC Name | 3-[(4E,6Z)-4-chloro-3-methylnona-4,6,8-trien-2-yl]phosphanyl-5-[6-[2-(1-oxopropan-2-ylamino)ethyl]benzimidazol-1-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | C=C/C=C\C=C(\Cl)C(C)C(C)Pc1cc(-n2cnc3ccc(CCNC(C)C=O)cc32)sc1C(N)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H32ClN4O2PS.C2HF3O2/c1-5-6-7-8-21(28)18(3)19(4)35-24-14-25(36-26(24)27(29)34)32-16-31-22-10-9-20(13-23(22)32)11-12-30-17(2)15-33;3-2(4,5)1(6)7/h5-10,13-19,30,35H,1,11-12H2,2-4H3,(H2,29,34);(H,6,7)/b7-6-,21-8+; |
| InChIKey | VCWABJMPBHDZKF-YKWNPUGCSA-N |
| XLogP | 5.73 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.10 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|