C27H25ClFN4OPS — CID 143424801
3-[(4E,6Z)-4-chloro-3-methylnona-4,6,8-trien-2-yl]phosphanyl-5-[5-(2-fluoro-4-pyridinyl)benzimidazol-1-yl]thiophene-2-carboxamide (PubChem CID 143424801) has the molecular formula C27H25ClFN4OPS and a molecular weight of 539.02 g/mol. Its IUPAC name is 3-[(4E,6Z)-4-chloro-3-methylnona-4,6,8-trien-2-yl]phosphanyl-5-[5-(2-fluoro-4-pyridinyl)benzimidazol-1-yl]thiophene-2-carboxamide.
| Compound Name | 3-[(4E,6Z)-4-chloro-3-methylnona-4,6,8-trien-2-yl]phosphanyl-5-[5-(2-fluoro-4-pyridinyl)benzimidazol-1-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 143424801 |
| Molecular Formula | C27H25ClFN4OPS |
| Molecular Weight | 539.02 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 3-[(4E,6Z)-4-chloro-3-methylnona-4,6,8-trien-2-yl]phosphanyl-5-[5-(2-fluoro-4-pyridinyl)benzimidazol-1-yl]thiophene-2-carboxamide |
| SMILES | C=C/C=C\C=C(\Cl)C(C)C(C)Pc1cc(-n2cnc3cc(-c4ccnc(F)c4)ccc32)sc1C(N)=O |
| InChI | InChI=1S/C27H25ClFN4OPS/c1-4-5-6-7-20(28)16(2)17(3)35-23-14-25(36-26(23)27(30)34)33-15-32-21-12-18(8-9-22(21)33)19-10-11-31-24(29)13-19/h4-17,35H,1H2,2-3H3,(H2,30,34)/b6-5-,20-7+ |
| InChIKey | VFOMJXWUHCRXTN-GNTSWZRDSA-N |
| XLogP | 6.58 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.02 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|